C21H19N3OS — CID 22306374
1-(3-methylphenyl)-1-[(4-phenylbenzoyl)amino]thiourea (PubChem CID 22306374) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-(3-methylphenyl)-1-[(4-phenylbenzoyl)amino]thiourea.
| Compound Name | 1-(3-methylphenyl)-1-[(4-phenylbenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 22306374 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 1-(3-methylphenyl)-1-[(4-phenylbenzoyl)amino]thiourea |
| SMILES | Cc1cccc(N(NC(=O)c2ccc(-c3ccccc3)cc2)C(N)=S)c1 |
| InChI | InChI=1S/C21H19N3OS/c1-15-6-5-9-19(14-15)24(21(22)26)23-20(25)18-12-10-17(11-13-18)16-7-3-2-4-8-16/h2-14H,1H3,(H2,22,26)(H,23,25) |
| InChIKey | RMIMAJBJPPHNCV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|