C21H21N3OS2 — CID 20849809
1-(3-methylphenyl)-1-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea (PubChem CID 20849809) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-(3-methylphenyl)-1-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea.
| Compound Name | 1-(3-methylphenyl)-1-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 20849809 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-(3-methylphenyl)-1-[[2-(naphthalen-1-ylmethylsulfanyl)acetyl]amino]thiourea |
| SMILES | Cc1cccc(N(NC(=O)CSCc2cccc3ccccc23)C(N)=S)c1 |
| InChI | InChI=1S/C21H21N3OS2/c1-15-6-4-10-18(12-15)24(21(22)26)23-20(25)14-27-13-17-9-5-8-16-7-2-3-11-19(16)17/h2-12H,13-14H2,1H3,(H2,22,26)(H,23,25) |
| InChIKey | XIXQGCGXNNYOSI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|