C21H19O4S- — CID 22306867
4-methoxy-2,5-bis(2-methylphenyl)benzenesulfonate (PubChem CID 22306867) has the molecular formula C21H19O4S- and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-methoxy-2,5-bis(2-methylphenyl)benzenesulfonate.
| Compound Name | 4-methoxy-2,5-bis(2-methylphenyl)benzenesulfonate |
|---|---|
| PubChem CID | 22306867 |
| Molecular Formula | C21H19O4S- |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 4-methoxy-2,5-bis(2-methylphenyl)benzenesulfonate |
| SMILES | COc1cc(-c2ccccc2C)c(S(=O)(=O)[O-])cc1-c1ccccc1C |
| InChI | InChI=1S/C21H20O4S/c1-14-8-4-6-10-16(14)18-13-21(26(22,23)24)19(12-20(18)25-3)17-11-7-5-9-15(17)2/h4-13H,1-3H3,(H,22,23,24)/p-1 |
| InChIKey | XIWGAWPREDUQLX-UHFFFAOYSA-M |
| XLogP | 4.55 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|