C21H31N3OS — CID 22308267
1-butyl-3-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethylsulfanyl]urea (PubChem CID 22308267) has the molecular formula C21H31N3OS and a molecular weight of 373.57 g/mol. Its IUPAC name is 1-butyl-3-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethylsulfanyl]urea.
| Compound Name | 1-butyl-3-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethylsulfanyl]urea |
|---|---|
| PubChem CID | 22308267 |
| Molecular Formula | C21H31N3OS |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 1-butyl-3-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethylsulfanyl]urea |
| SMILES | CCCCNC(=O)NSCCC1C(c2c(C)[nH]c3ccccc23)C1(C)C |
| InChI | InChI=1S/C21H31N3OS/c1-5-6-12-22-20(25)24-26-13-11-16-19(21(16,3)4)18-14(2)23-17-10-8-7-9-15(17)18/h7-10,16,19,23H,5-6,11-13H2,1-4H3,(H2,22,24,25) |
| InChIKey | RSPJJWJYGBMURR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|