C21H24N2O2 — CID 2717080
N-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]furan-2-carboxamide (PubChem CID 2717080) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2717080 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[2-[(1S,3S)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]furan-2-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1[C@H]1[C@H](CCNC(=O)c2ccco2)C1(C)C |
| InChI | InChI=1S/C21H24N2O2/c1-13-18(14-7-4-5-8-16(14)23-13)19-15(21(19,2)3)10-11-22-20(24)17-9-6-12-25-17/h4-9,12,15,19,23H,10-11H2,1-3H3,(H,22,24)/t15-,19+/m0/s1 |
| InChIKey | RYNNDFMUPGRFQM-HNAYVOBHSA-N |
| XLogP | 4.63 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|