C23H26ClN3S — CID 92918112
1-(4-chlorophenyl)-3-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]thiourea (PubChem CID 92918112) has the molecular formula C23H26ClN3S and a molecular weight of 412.00 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]thiourea |
|---|---|
| PubChem CID | 92918112 |
| Molecular Formula | C23H26ClN3S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-[(1S,3R)-2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]thiourea |
| SMILES | Cc1[nH]c2ccccc2c1[C@@H]1[C@H](CCNC(=S)Nc2ccc(Cl)cc2)C1(C)C |
| InChI | InChI=1S/C23H26ClN3S/c1-14-20(17-6-4-5-7-19(17)26-14)21-18(23(21,2)3)12-13-25-22(28)27-16-10-8-15(24)9-11-16/h4-11,18,21,26H,12-13H2,1-3H3,(H2,25,27,28)/t18-,21-/m0/s1 |
| InChIKey | ZONYZKLNGMMSCG-RXVVDRJESA-N |
| XLogP | 6.25 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|