C31H25N5S — CID 143655481
1-[2-(2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-phenanthro[9,10-d]imidazol-5-yl]-3-phenylthiourea (PubChem CID 143655481) has the molecular formula C31H25N5S and a molecular weight of 499.64 g/mol. Its IUPAC name is 1-[2-(2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-phenanthro[9,10-d]imidazol-5-yl]-3-phenylthiourea.
| Compound Name | 1-[2-(2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-phenanthro[9,10-d]imidazol-5-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 143655481 |
| Molecular Formula | C31H25N5S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[2-(2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-phenanthro[9,10-d]imidazol-5-yl]-3-phenylthiourea |
| SMILES | Cc1[nH]c2ccccc2c1C1Nc2c(c3cc(NC(=S)Nc4ccccc4)ccc3c3ccccc23)N1 |
| InChI | InChI=1S/C31H25N5S/c1-18-27(24-13-7-8-14-26(24)32-18)30-35-28-23-12-6-5-11-21(23)22-16-15-20(17-25(22)29(28)36-30)34-31(37)33-19-9-3-2-4-10-19/h2-17,30,32,35-36H,1H3,(H2,33,34,37) |
| InChIKey | IMGZKXXBKJJPIM-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|