C32H24N4S — CID 157056388
1-[2-(2-methyl-1H-indol-3-yl)-3H-phenanthro[9,10-b]pyrrol-5-yl]-3-phenylthiourea (PubChem CID 157056388) has the molecular formula C32H24N4S and a molecular weight of 496.64 g/mol. Its IUPAC name is 1-[2-(2-methyl-1H-indol-3-yl)-3H-phenanthro[9,10-b]pyrrol-5-yl]-3-phenylthiourea.
| Compound Name | 1-[2-(2-methyl-1H-indol-3-yl)-3H-phenanthro[9,10-b]pyrrol-5-yl]-3-phenylthiourea |
|---|---|
| PubChem CID | 157056388 |
| Molecular Formula | C32H24N4S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-[2-(2-methyl-1H-indol-3-yl)-3H-phenanthro[9,10-b]pyrrol-5-yl]-3-phenylthiourea |
| SMILES | Cc1[nH]c2ccccc2c1C1=Nc2c(c3cc(NC(=S)Nc4ccccc4)ccc3c3ccccc23)C1 |
| InChI | InChI=1S/C32H24N4S/c1-19-30(25-13-7-8-14-28(25)33-19)29-18-27-26-17-21(35-32(37)34-20-9-3-2-4-10-20)15-16-23(26)22-11-5-6-12-24(22)31(27)36-29/h2-17,33H,18H2,1H3,(H2,34,35,37) |
| InChIKey | JRFQDXYGOVBLJM-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|