C26H32N2O4 — CID 4874241
N-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 4874241) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4874241 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[2-[2,2-dimethyl-3-(2-methyl-1H-indol-3-yl)cyclopropyl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCC2C(c3c(C)[nH]c4ccccc34)C2(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N2O4/c1-15-22(17-9-7-8-10-19(17)28-15)23-18(26(23,2)3)11-12-27-25(29)16-13-20(30-4)24(32-6)21(14-16)31-5/h7-10,13-14,18,23,28H,11-12H2,1-6H3,(H,27,29) |
| InChIKey | CBTYLGPNCJDTLV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|