C18H26O10S2 — CID 22308806
1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,2-bis(methylsulfonyl)ethane-1,2-diol (PubChem CID 22308806) has the molecular formula C18H26O10S2 and a molecular weight of 466.53 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,2-bis(methylsulfonyl)ethane-1,2-diol.
| Compound Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,2-bis(methylsulfonyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 22308806 |
| Molecular Formula | C18H26O10S2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,2-bis(methylsulfonyl)ethane-1,2-diol |
| SMILES | CC1(C)O[C@H]2O[C@H](C(O)(C(O)S(C)(=O)=O)S(C)(=O)=O)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C18H26O10S2/c1-17(2)27-13-12(25-10-11-8-6-5-7-9-11)14(26-15(13)28-17)18(20,30(4,23)24)16(19)29(3,21)22/h5-9,12-16,19-20H,10H2,1-4H3/t12-,13-,14+,15-,16?,18?/m1/s1 |
| InChIKey | RNXUVTVFUSVEHI-ULJLEJDWSA-N |
| XLogP | -0.46 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |