C30H39N7O7 — CID 22314661
12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1-oxa-4,7,10-triazacyclopentadecane-3-carboxylic acid (PubChem CID 22314661) has the molecular formula C30H39N7O7 and a molecular weight of 609.68 g/mol. Its IUPAC name is 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1-oxa-4,7,10-triazacyclopentadecane-3-carboxylic acid.
| Compound Name | 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1-oxa-4,7,10-triazacyclopentadecane-3-carboxylic acid |
|---|---|
| PubChem CID | 22314661 |
| Molecular Formula | C30H39N7O7 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1-oxa-4,7,10-triazacyclopentadecane-3-carboxylic acid |
| SMILES | NC(N)=NCCCC1NC(=O)C(Cc2ccccc2)NC(=O)C(NC(=O)c2ccccc2)CCCOCC(C(=O)O)NC1=O |
| InChI | InChI=1S/C30H39N7O7/c31-30(32)33-15-7-13-21-27(40)37-24(29(42)43)18-44-16-8-14-22(34-25(38)20-11-5-2-6-12-20)26(39)36-23(28(41)35-21)17-19-9-3-1-4-10-19/h1-6,9-12,21-24H,7-8,13-18H2,(H,34,38)(H,35,41)(H,36,39)(H,37,40)(H,42,43)(H4,31,32,33) |
| InChIKey | ZEYRWFZMFRMBJE-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 227.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|