C32H43N7O8 — CID 22314663
12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1,15-dioxa-4,7,10-triazacyclooctadecane-3-carboxylic acid (PubChem CID 22314663) has the molecular formula C32H43N7O8 and a molecular weight of 653.74 g/mol. Its IUPAC name is 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1,15-dioxa-4,7,10-triazacyclooctadecane-3-carboxylic acid.
| Compound Name | 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1,15-dioxa-4,7,10-triazacyclooctadecane-3-carboxylic acid |
|---|---|
| PubChem CID | 22314663 |
| Molecular Formula | C32H43N7O8 |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | 12-benzamido-9-benzyl-6-[3-(diaminomethylideneamino)propyl]-5,8,11-trioxo-1,15-dioxa-4,7,10-triazacyclooctadecane-3-carboxylic acid |
| SMILES | NC(N)=NCCCC1NC(=O)C(Cc2ccccc2)NC(=O)C(NC(=O)c2ccccc2)CCOCCCOCC(C(=O)O)NC1=O |
| InChI | InChI=1S/C32H43N7O8/c33-32(34)35-15-7-13-23-28(41)39-26(31(44)45)20-47-17-8-16-46-18-14-24(36-27(40)22-11-5-2-6-12-22)29(42)38-25(30(43)37-23)19-21-9-3-1-4-10-21/h1-6,9-12,23-26H,7-8,13-20H2,(H,36,40)(H,37,43)(H,38,42)(H,39,41)(H,44,45)(H4,33,34,35) |
| InChIKey | LLSLKYFYSAXXNB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 236.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|