C28H41NO3S — CID 22325238
3-butyl-3-ethyl-7-(hexylamino)-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 22325238) has the molecular formula C28H41NO3S and a molecular weight of 471.71 g/mol. Its IUPAC name is 3-butyl-3-ethyl-7-(hexylamino)-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | 3-butyl-3-ethyl-7-(hexylamino)-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 22325238 |
| Molecular Formula | C28H41NO3S |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | 3-butyl-3-ethyl-7-(hexylamino)-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCCCNc1ccc2c(c1)C(c1ccccc1)C(O)C(CC)(CCCC)CS2(=O)=O |
| InChI | InChI=1S/C28H41NO3S/c1-4-7-9-13-19-29-23-16-17-25-24(20-23)26(22-14-11-10-12-15-22)27(30)28(6-3,18-8-5-2)21-33(25,31)32/h10-12,14-17,20,26-27,29-30H,4-9,13,18-19,21H2,1-3H3 |
| InChIKey | JFUWHXRFYNRIHP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|