C25H35FNO3S+ — CID 59890351
[4-[(4R,5R)-3-butyl-3-ethyl-7-fluoro-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium (PubChem CID 59890351) has the molecular formula C25H35FNO3S+ and a molecular weight of 448.62 g/mol. Its IUPAC name is [4-[(4R,5R)-3-butyl-3-ethyl-7-fluoro-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium.
| Compound Name | [4-[(4R,5R)-3-butyl-3-ethyl-7-fluoro-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium |
|---|---|
| PubChem CID | 59890351 |
| Molecular Formula | C25H35FNO3S+ |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [4-[(4R,5R)-3-butyl-3-ethyl-7-fluoro-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium |
| SMILES | CCCCC1(CC)CS(=O)(=O)c2ccc(F)cc2[C@@H](c2ccc([N+](C)(C)C)cc2)[C@H]1O |
| InChI | InChI=1S/C25H35FNO3S/c1-6-8-15-25(7-2)17-31(29,30)22-14-11-19(26)16-21(22)23(24(25)28)18-9-12-20(13-10-18)27(3,4)5/h9-14,16,23-24,28H,6-8,15,17H2,1-5H3/q+1/t23-,24-,25?/m1/s1 |
| InChIKey | VRKCTOBTZWJKJE-AEAWWFNXSA-N |
| XLogP | 4.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|