C22H27IO3S — CID 54200974
(3S,4S,5S)-3-butyl-3-ethyl-5-(4-iodophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 54200974) has the molecular formula C22H27IO3S and a molecular weight of 498.43 g/mol. Its IUPAC name is (3S,4S,5S)-3-butyl-3-ethyl-5-(4-iodophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (3S,4S,5S)-3-butyl-3-ethyl-5-(4-iodophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 54200974 |
| Molecular Formula | C22H27IO3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (3S,4S,5S)-3-butyl-3-ethyl-5-(4-iodophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2ccccc2[C@H](c2ccc(I)cc2)[C@@H]1O |
| InChI | InChI=1S/C22H27IO3S/c1-3-5-14-22(4-2)15-27(25,26)19-9-7-6-8-18(19)20(21(22)24)16-10-12-17(23)13-11-16/h6-13,20-21,24H,3-5,14-15H2,1-2H3/t20-,21-,22+/m0/s1 |
| InChIKey | PPFBHLNIPFHQGD-FDFHNCONSA-N |
| XLogP | 5.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|