About CID 22325818
CID 22325818 (PubChem CID 22325818) has the molecular formula C6H18O3Si3
and a molecular weight of 222.46 g/mol.
Molecular Properties
| Compound Name | CID 22325818 |
| PubChem CID | 22325818 |
| Molecular Formula | C6H18O3Si3 |
| Molecular Weight | 222.46 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | — |
| SMILES | CC[Si](O)(O[Si](C)C)O[Si](C)C |
| InChI | InChI=1S/C6H18O3Si3/c1-6-12(7,8-10(2)3)9-11(4)5/h7H,6H2,1-5H3 |
| InChIKey | BNHKYQFIJJQQHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22325818 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22325818?
The IUPAC name of CID 22325818 (CID 22325818) is not available.
What is the SMILES notation for CID 22325818?
The canonical SMILES for CID 22325818 is CC[Si](O)(O[Si](C)C)O[Si](C)C.
What is the InChIKey of CID 22325818?
The InChIKey is BNHKYQFIJJQQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18O3Si3/c1-6-12(7,8-10(2)3)9-11(4)5/h7H,6H2,1-5H3.
What are the key properties of CID 22325818?
CID 22325818 has a molecular weight of 222.46 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22325818 is sourced from PubChem (CID 22325818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).