About ethoxyethane;5-hydroxypentan-2-one
ethoxyethane;5-hydroxypentan-2-one (PubChem CID 22325863) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is ethoxyethane;5-hydroxypentan-2-one.
Molecular Properties
| Compound Name | ethoxyethane;5-hydroxypentan-2-one |
| PubChem CID | 22325863 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | ethoxyethane;5-hydroxypentan-2-one |
| SMILES | CC(=O)CCCO.CCOCC |
| InChI | InChI=1S/C5H10O2.C4H10O/c1-5(7)3-2-4-6;1-3-5-4-2/h6H,2-4H2,1H3;3-4H2,1-2H3 |
| InChIKey | KPARZQMHPMAPHL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethoxyethane;5-hydroxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;5-hydroxypentan-2-one?
The IUPAC name of ethoxyethane;5-hydroxypentan-2-one (CID 22325863) is ethoxyethane;5-hydroxypentan-2-one.
What is the SMILES notation for ethoxyethane;5-hydroxypentan-2-one?
The canonical SMILES for ethoxyethane;5-hydroxypentan-2-one is CC(=O)CCCO.CCOCC.
What is the InChIKey of ethoxyethane;5-hydroxypentan-2-one?
The InChIKey is KPARZQMHPMAPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H10O/c1-5(7)3-2-4-6;1-3-5-4-2/h6H,2-4H2,1H3;3-4H2,1-2H3.
What are the key properties of ethoxyethane;5-hydroxypentan-2-one?
ethoxyethane;5-hydroxypentan-2-one has a molecular weight of 176.26 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;5-hydroxypentan-2-one is sourced from PubChem (CID 22325863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).