C16H19FN2O7 — CID 22326668
4-[[3-fluoro-4-(2-methoxy-2-oxoethoxy)-5-nitrophenyl]methyl]piperidine-1-carboxylic acid (PubChem CID 22326668) has the molecular formula C16H19FN2O7 and a molecular weight of 370.33 g/mol. Its IUPAC name is 4-[[3-fluoro-4-(2-methoxy-2-oxoethoxy)-5-nitrophenyl]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[3-fluoro-4-(2-methoxy-2-oxoethoxy)-5-nitrophenyl]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22326668 |
| Molecular Formula | C16H19FN2O7 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[[3-fluoro-4-(2-methoxy-2-oxoethoxy)-5-nitrophenyl]methyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)COc1c(F)cc(CC2CCN(C(=O)O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19FN2O7/c1-25-14(20)9-26-15-12(17)7-11(8-13(15)19(23)24)6-10-2-4-18(5-3-10)16(21)22/h7-8,10H,2-6,9H2,1H3,(H,21,22) |
| InChIKey | QKWRRVAXRRPGBQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|