C11H11F2N3O4 — CID 67135803
4-(5,6-difluoro-3-nitro-2-pyridinyl)piperidine-1-carboxylic acid (PubChem CID 67135803) has the molecular formula C11H11F2N3O4 and a molecular weight of 287.22 g/mol. Its IUPAC name is 4-(5,6-difluoro-3-nitro-2-pyridinyl)piperidine-1-carboxylic acid.
| Compound Name | 4-(5,6-difluoro-3-nitro-2-pyridinyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67135803 |
| Molecular Formula | C11H11F2N3O4 |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-(5,6-difluoro-3-nitro-2-pyridinyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2nc(F)c(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H11F2N3O4/c12-7-5-8(16(19)20)9(14-10(7)13)6-1-3-15(4-2-6)11(17)18/h5-6H,1-4H2,(H,17,18) |
| InChIKey | BUOIGBTYXXQIAA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|