C10H21N3O2 — CID 2232760
N-butyl-4-(2,2-dimethylhydrazinyl)-4-oxobutanamide (PubChem CID 2232760) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-butyl-4-(2,2-dimethylhydrazinyl)-4-oxobutanamide.
| Compound Name | N-butyl-4-(2,2-dimethylhydrazinyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 2232760 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | N-butyl-4-(2,2-dimethylhydrazinyl)-4-oxobutanamide |
| SMILES | CCCCNC(=O)CCC(=O)NN(C)C |
| InChI | InChI=1S/C10H21N3O2/c1-4-5-8-11-9(14)6-7-10(15)12-13(2)3/h4-8H2,1-3H3,(H,11,14)(H,12,15) |
| InChIKey | HYAKWFUUWFQFMZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|