C18H18Cl2N2S — CID 22327620
N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(1H-indol-3-yl)ethanamine (PubChem CID 22327620) has the molecular formula C18H18Cl2N2S and a molecular weight of 365.33 g/mol. Its IUPAC name is N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 22327620 |
| Molecular Formula | C18H18Cl2N2S |
| Molecular Weight | 365.33 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[2-(2,5-dichlorophenyl)sulfanylethyl]-1-(1H-indol-3-yl)ethanamine |
| SMILES | CC(NCCSc1cc(Cl)ccc1Cl)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H18Cl2N2S/c1-12(15-11-22-17-5-3-2-4-14(15)17)21-8-9-23-18-10-13(19)6-7-16(18)20/h2-7,10-12,21-22H,8-9H2,1H3 |
| InChIKey | NLUBPLLRDIMAPW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|