C26H37N3O3S — CID 22333625
N-cyclohexyl-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-oxo-3-pentylquinazoline-7-carboxamide (PubChem CID 22333625) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-oxo-3-pentylquinazoline-7-carboxamide.
| Compound Name | N-cyclohexyl-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-oxo-3-pentylquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 22333625 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-cyclohexyl-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-oxo-3-pentylquinazoline-7-carboxamide |
| SMILES | CCCCCn1c(SCC(=O)C(C)(C)C)nc2cc(C(=O)NC3CCCCC3)ccc2c1=O |
| InChI | InChI=1S/C26H37N3O3S/c1-5-6-10-15-29-24(32)20-14-13-18(23(31)27-19-11-8-7-9-12-19)16-21(20)28-25(29)33-17-22(30)26(2,3)4/h13-14,16,19H,5-12,15,17H2,1-4H3,(H,27,31) |
| InChIKey | ORRPZJCHWACWOC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|