C26H20Cl2N4O6 — CID 22339402
2-[3,5-dichloro-4-[4-hydroxy-3-(8-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenoxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 22339402) has the molecular formula C26H20Cl2N4O6 and a molecular weight of 555.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-hydroxy-3-(8-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenoxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[4-hydroxy-3-(8-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenoxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 22339402 |
| Molecular Formula | C26H20Cl2N4O6 |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-hydroxy-3-(8-methoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)phenoxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | COc1cccc2c1CN(C(=O)c1cc(Oc3c(Cl)cc(-n4ncc(=O)[nH]c4=O)cc3Cl)ccc1O)CC2 |
| InChI | InChI=1S/C26H20Cl2N4O6/c1-37-22-4-2-3-14-7-8-31(13-18(14)22)25(35)17-11-16(5-6-21(17)33)38-24-19(27)9-15(10-20(24)28)32-26(36)30-23(34)12-29-32/h2-6,9-12,33H,7-8,13H2,1H3,(H,30,34,36) |
| InChIKey | KKCWOELFFQLIRJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |