C25H20Cl2N4O4 — CID 22339746
2-[3,5-dichloro-4-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-hydroxyphenoxy]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 22339746) has the molecular formula C25H20Cl2N4O4 and a molecular weight of 511.37 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-hydroxyphenoxy]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-hydroxyphenoxy]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 22339746 |
| Molecular Formula | C25H20Cl2N4O4 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-[3,5-dichloro-4-[3-(3,4-dihydro-2H-quinolin-1-ylmethyl)-4-hydroxyphenoxy]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2cc(Cl)c(Oc3ccc(O)c(CN4CCCc5ccccc54)c3)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H20Cl2N4O4/c26-19-11-17(31-25(34)29-23(33)13-28-31)12-20(27)24(19)35-18-7-8-22(32)16(10-18)14-30-9-3-5-15-4-1-2-6-21(15)30/h1-2,4,6-8,10-13,32H,3,5,9,14H2,(H,29,33,34) |
| InChIKey | ZWYWEOZHSFYAMJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|