C27H22Cl2N4O6 — CID 22339685
5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-hydroxy-N-methylbenzamide (PubChem CID 22339685) has the molecular formula C27H22Cl2N4O6 and a molecular weight of 569.40 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-hydroxy-N-methylbenzamide.
| Compound Name | 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 22339685 |
| Molecular Formula | C27H22Cl2N4O6 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 5-[2,6-dichloro-4-(3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N-(3,4-dihydro-2H-chromen-4-ylmethyl)-2-hydroxy-N-methylbenzamide |
| SMILES | CN(CC1CCOc2ccccc21)C(=O)c1cc(Oc2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)ccc1O |
| InChI | InChI=1S/C27H22Cl2N4O6/c1-32(14-15-8-9-38-23-5-3-2-4-18(15)23)26(36)19-12-17(6-7-22(19)34)39-25-20(28)10-16(11-21(25)29)33-27(37)31-24(35)13-30-33/h2-7,10-13,15,34H,8-9,14H2,1H3,(H,31,35,37) |
| InChIKey | RPZBYQPBJBPIRL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |