C23H21F4NO4S — CID 22340161
1,1,1-trifluoro-N-[3-[2-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methoxy]ethyl]phenyl]methanesulfonamide (PubChem CID 22340161) has the molecular formula C23H21F4NO4S and a molecular weight of 483.48 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-[2-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methoxy]ethyl]phenyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-[2-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methoxy]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22340161 |
| Molecular Formula | C23H21F4NO4S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-[2-[[4-fluoro-3-(4-methoxyphenyl)phenyl]methoxy]ethyl]phenyl]methanesulfonamide |
| SMILES | COc1ccc(-c2cc(COCCc3cccc(NS(=O)(=O)C(F)(F)F)c3)ccc2F)cc1 |
| InChI | InChI=1S/C23H21F4NO4S/c1-31-20-8-6-18(7-9-20)21-14-17(5-10-22(21)24)15-32-12-11-16-3-2-4-19(13-16)28-33(29,30)23(25,26)27/h2-10,13-14,28H,11-12,15H2,1H3 |
| InChIKey | PKYUQXKOQHKDLG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|