C8H22N2O3Si — CID 22341658
1-N'-(1-trimethoxysilylethyl)propane-1,1-diamine (PubChem CID 22341658) has the molecular formula C8H22N2O3Si and a molecular weight of 222.36 g/mol. Its IUPAC name is 1-N'-(1-trimethoxysilylethyl)propane-1,1-diamine.
| Compound Name | 1-N'-(1-trimethoxysilylethyl)propane-1,1-diamine |
|---|---|
| PubChem CID | 22341658 |
| Molecular Formula | C8H22N2O3Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-N'-(1-trimethoxysilylethyl)propane-1,1-diamine |
| SMILES | CCC(N)NC(C)[Si](OC)(OC)OC |
| InChI | InChI=1S/C8H22N2O3Si/c1-6-8(9)10-7(2)14(11-3,12-4)13-5/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | ZKSQJCIPERDFIA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|