C8H22N4 — CID 20981244
1-N'-[1-(2-aminopropylamino)ethyl]propane-1,1-diamine (PubChem CID 20981244) has the molecular formula C8H22N4 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-N'-[1-(2-aminopropylamino)ethyl]propane-1,1-diamine.
| Compound Name | 1-N'-[1-(2-aminopropylamino)ethyl]propane-1,1-diamine |
|---|---|
| PubChem CID | 20981244 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | 1-N'-[1-(2-aminopropylamino)ethyl]propane-1,1-diamine |
| SMILES | CCC(N)NC(C)NCC(C)N |
| InChI | InChI=1S/C8H22N4/c1-4-8(10)12-7(3)11-5-6(2)9/h6-8,11-12H,4-5,9-10H2,1-3H3 |
| InChIKey | YWDVSHICRSYYMA-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|