C5H16N2Si — CID 173101185
1-N'-(1-silylethyl)propane-1,1-diamine (PubChem CID 173101185) has the molecular formula C5H16N2Si and a molecular weight of 132.28 g/mol. Its IUPAC name is 1-N'-(1-silylethyl)propane-1,1-diamine.
| Compound Name | 1-N'-(1-silylethyl)propane-1,1-diamine |
|---|---|
| PubChem CID | 173101185 |
| Molecular Formula | C5H16N2Si |
| Molecular Weight | 132.28 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | 1-N'-(1-silylethyl)propane-1,1-diamine |
| SMILES | CCC(N)NC(C)[SiH3] |
| InChI | InChI=1S/C5H16N2Si/c1-3-5(6)7-4(2)8/h4-5,7H,3,6H2,1-2,8H3 |
| InChIKey | GTIGXOUVOIEAJB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.28 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|