About butan-2-amine;formonitrile
butan-2-amine;formonitrile (PubChem CID 157293075) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is butan-2-amine;formonitrile.
Molecular Properties
| Compound Name | butan-2-amine;formonitrile |
| PubChem CID | 157293075 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | butan-2-amine;formonitrile |
| SMILES | C#N.CCC(C)N |
| InChI | InChI=1S/C4H11N.CHN/c1-3-4(2)5;1-2/h4H,3,5H2,1-2H3;1H |
| InChIKey | BBAKWVVMHUPNBA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-amine;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-amine;formonitrile?
The IUPAC name of butan-2-amine;formonitrile (CID 157293075) is butan-2-amine;formonitrile.
What is the SMILES notation for butan-2-amine;formonitrile?
The canonical SMILES for butan-2-amine;formonitrile is C#N.CCC(C)N.
What is the InChIKey of butan-2-amine;formonitrile?
The InChIKey is BBAKWVVMHUPNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.CHN/c1-3-4(2)5;1-2/h4H,3,5H2,1-2H3;1H.
What are the key properties of butan-2-amine;formonitrile?
butan-2-amine;formonitrile has a molecular weight of 100.16 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-amine;formonitrile is sourced from PubChem (CID 157293075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).