About butan-2-amine;octan-4-amine
butan-2-amine;octan-4-amine (PubChem CID 87595961) has the molecular formula C12H30N2
and a molecular weight of 202.39 g/mol. Its IUPAC name is butan-2-amine;octan-4-amine.
Molecular Properties
| Compound Name | butan-2-amine;octan-4-amine |
| PubChem CID | 87595961 |
| Molecular Formula | C12H30N2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.24 |
| IUPAC Name | butan-2-amine;octan-4-amine |
| SMILES | CCC(C)N.CCCCC(N)CCC |
| InChI | InChI=1S/C8H19N.C4H11N/c1-3-5-7-8(9)6-4-2;1-3-4(2)5/h8H,3-7,9H2,1-2H3;4H,3,5H2,1-2H3 |
| InChIKey | AZELIGYALAAAGE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-amine;octan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-amine;octan-4-amine?
The IUPAC name of butan-2-amine;octan-4-amine (CID 87595961) is butan-2-amine;octan-4-amine.
What is the SMILES notation for butan-2-amine;octan-4-amine?
The canonical SMILES for butan-2-amine;octan-4-amine is CCC(C)N.CCCCC(N)CCC.
What is the InChIKey of butan-2-amine;octan-4-amine?
The InChIKey is AZELIGYALAAAGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C4H11N/c1-3-5-7-8(9)6-4-2;1-3-4(2)5/h8H,3-7,9H2,1-2H3;4H,3,5H2,1-2H3.
What are the key properties of butan-2-amine;octan-4-amine?
butan-2-amine;octan-4-amine has a molecular weight of 202.39 g/mol, XLogP of 3.05, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-amine;octan-4-amine is sourced from PubChem (CID 87595961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).