C23H27N5O — CID 22344427
1-(3-aminobutyl)-2-(3-phenoxypropyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 22344427) has the molecular formula C23H27N5O and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-(3-aminobutyl)-2-(3-phenoxypropyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(3-aminobutyl)-2-(3-phenoxypropyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 22344427 |
| Molecular Formula | C23H27N5O |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-(3-aminobutyl)-2-(3-phenoxypropyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | CC(N)CCn1c(CCCOc2ccccc2)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C23H27N5O/c1-16(24)13-14-28-20(12-7-15-29-17-8-3-2-4-9-17)27-21-22(28)18-10-5-6-11-19(18)26-23(21)25/h2-6,8-11,16H,7,12-15,24H2,1H3,(H2,25,26) |
| InChIKey | WEDAMQZTNRHKAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|