C22H22ClN3O3 — CID 22348141
4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-chloro-1H-quinolin-2-one (PubChem CID 22348141) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-chloro-1H-quinolin-2-one.
| Compound Name | 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-chloro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 22348141 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-chloro-1H-quinolin-2-one |
| SMILES | O=c1cc(N(Cc2ccc3c(c2)OCO3)C2CCNCC2)c2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-15-2-3-18-17(10-15)19(11-22(27)25-18)26(16-5-7-24-8-6-16)12-14-1-4-20-21(9-14)29-13-28-20/h1-4,9-11,16,24H,5-8,12-13H2,(H,25,27) |
| InChIKey | VVXHHPSHNFONSH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |