C23H24N2O5 — CID 22348263
4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one (PubChem CID 22348263) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one.
| Compound Name | 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one |
|---|---|
| PubChem CID | 22348263 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-[1,3-benzodioxol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc(N(Cc3ccc4c(c3)OCO4)C3CCNCC3)c2c1 |
| InChI | InChI=1S/C23H24N2O5/c1-27-17-3-5-20-18(11-17)19(12-23(26)30-20)25(16-6-8-24-9-7-16)13-15-2-4-21-22(10-15)29-14-28-21/h2-5,10-12,16,24H,6-9,13-14H2,1H3 |
| InChIKey | YUSPBGSTIWVWNR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|