About heptan-2-ylphosphanium
heptan-2-ylphosphanium (PubChem CID 22349024) has the molecular formula C7H18P+
and a molecular weight of 133.20 g/mol. Its IUPAC name is heptan-2-ylphosphanium.
Molecular Properties
| Compound Name | heptan-2-ylphosphanium |
| PubChem CID | 22349024 |
| Molecular Formula | C7H18P+ |
| Molecular Weight | 133.20 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | heptan-2-ylphosphanium |
| SMILES | CCCCCC(C)[PH3+] |
| InChI | InChI=1S/C7H17P/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3/p+1 |
| InChIKey | RNWFQZVXWOOAHL-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-ylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-ylphosphanium?
The IUPAC name of heptan-2-ylphosphanium (CID 22349024) is heptan-2-ylphosphanium.
What is the SMILES notation for heptan-2-ylphosphanium?
The canonical SMILES for heptan-2-ylphosphanium is CCCCCC(C)[PH3+].
What is the InChIKey of heptan-2-ylphosphanium?
The InChIKey is RNWFQZVXWOOAHL-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H17P/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3/p+1.
What are the key properties of heptan-2-ylphosphanium?
heptan-2-ylphosphanium has a molecular weight of 133.20 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-ylphosphanium is sourced from PubChem (CID 22349024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).