C15H12N2O4S — CID 22349939
2-(4-methylsulfonylphenyl)-3-pyridin-4-yl-1,2-oxazol-5-one (PubChem CID 22349939) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-3-pyridin-4-yl-1,2-oxazol-5-one.
| Compound Name | 2-(4-methylsulfonylphenyl)-3-pyridin-4-yl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 22349939 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-3-pyridin-4-yl-1,2-oxazol-5-one |
| SMILES | CS(=O)(=O)c1ccc(-n2oc(=O)cc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C15H12N2O4S/c1-22(19,20)13-4-2-12(3-5-13)17-14(10-15(18)21-17)11-6-8-16-9-7-11/h2-10H,1H3 |
| InChIKey | IOYOBJCYSNTLPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |