About zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride
zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride (PubChem CID 22351752) has the molecular formula C12H9ClO2S3Zn+2
and a molecular weight of 382.25 g/mol. Its IUPAC name is zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride |
| PubChem CID | 22351752 |
| Molecular Formula | C12H9ClO2S3Zn+2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 379.87 |
| IUPAC Name | zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(S)c(Sc2ccccc2)c1.[Zn+2] |
| InChI | InChI=1S/C12H9ClO2S3.Zn/c13-18(14,15)10-6-7-11(16)12(8-10)17-9-4-2-1-3-5-9;/h1-8,16H;/q;+2 |
| InChIKey | DVDJQWJODXKOAU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride?
The IUPAC name of zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride (CID 22351752) is zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride.
What is the SMILES notation for zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride?
The canonical SMILES for zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(S)c(Sc2ccccc2)c1.[Zn+2].
What is the InChIKey of zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride?
The InChIKey is DVDJQWJODXKOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClO2S3.Zn/c13-18(14,15)10-6-7-11(16)12(8-10)17-9-4-2-1-3-5-9;/h1-8,16H;/q;+2.
What are the key properties of zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride?
zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride has a molecular weight of 382.25 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 3-phenylsulfanyl-4-sulfanylbenzenesulfonyl chloride is sourced from PubChem (CID 22351752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).