C11H19O2- — CID 22352836
(E)-4,4-diethyl-2-methylhex-2-enoate (PubChem CID 22352836) has the molecular formula C11H19O2- and a molecular weight of 183.27 g/mol. Its IUPAC name is (E)-4,4-diethyl-2-methylhex-2-enoate.
| Compound Name | (E)-4,4-diethyl-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 22352836 |
| Molecular Formula | C11H19O2- |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (E)-4,4-diethyl-2-methylhex-2-enoate |
| SMILES | CCC(/C=C(\C)C(=O)[O-])(CC)CC |
| InChI | InChI=1S/C11H20O2/c1-5-11(6-2,7-3)8-9(4)10(12)13/h8H,5-7H2,1-4H3,(H,12,13)/p-1/b9-8+ |
| InChIKey | ATWSMHXVIFCZLW-CMDGGOBGSA-M |
| XLogP | 1.90 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|