C11H14O4-2 — CID 22364042
(2E,5E)-4-ethyl-2,6-dimethylhepta-2,5-dienedioate (PubChem CID 22364042) has the molecular formula C11H14O4-2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2E,5E)-4-ethyl-2,6-dimethylhepta-2,5-dienedioate.
| Compound Name | (2E,5E)-4-ethyl-2,6-dimethylhepta-2,5-dienedioate |
|---|---|
| PubChem CID | 22364042 |
| Molecular Formula | C11H14O4-2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (2E,5E)-4-ethyl-2,6-dimethylhepta-2,5-dienedioate |
| SMILES | CCC(/C=C(\C)C(=O)[O-])/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C11H16O4/c1-4-9(5-7(2)10(12)13)6-8(3)11(14)15/h5-6,9H,4H2,1-3H3,(H,12,13)(H,14,15)/p-2/b7-5+,8-6+ |
| InChIKey | JOJJOUOSKUJABD-KQQUZDAGSA-L |
| XLogP | -0.60 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|