C6H7N5O2 — CID 22353026
3,4-diamino-3,4-dicyano-2-iminobutanoic acid (PubChem CID 22353026) has the molecular formula C6H7N5O2 and a molecular weight of 181.16 g/mol. Its IUPAC name is 3,4-diamino-3,4-dicyano-2-iminobutanoic acid.
| Compound Name | 3,4-diamino-3,4-dicyano-2-iminobutanoic acid |
|---|---|
| PubChem CID | 22353026 |
| Molecular Formula | C6H7N5O2 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3,4-diamino-3,4-dicyano-2-iminobutanoic acid |
| SMILES | [H]/N=C(\C(=O)O)C(N)(C#N)C(N)C#N |
| InChI | InChI=1S/C6H7N5O2/c7-1-3(9)6(11,2-8)4(10)5(12)13/h3,10H,9,11H2,(H,12,13)/b10-4+ |
| InChIKey | YDYJYWFBPWKGRH-ONNFQVAWSA-N |
| XLogP | -1.84 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|