C11H13ClN2O3 — CID 22356450
3-(6-chloro-3-pyridinyl)-4-nitrocyclohexan-1-ol (PubChem CID 22356450) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-4-nitrocyclohexan-1-ol.
| Compound Name | 3-(6-chloro-3-pyridinyl)-4-nitrocyclohexan-1-ol |
|---|---|
| PubChem CID | 22356450 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-4-nitrocyclohexan-1-ol |
| SMILES | O=[N+]([O-])C1CCC(O)CC1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H13ClN2O3/c12-11-4-1-7(6-13-11)9-5-8(15)2-3-10(9)14(16)17/h1,4,6,8-10,15H,2-3,5H2 |
| InChIKey | ZTVHGTFNXVIDJE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|