About CID 22358458
CID 22358458 (PubChem CID 22358458) has the molecular formula C4H9N2OSi
and a molecular weight of 129.22 g/mol.
Molecular Properties
| Compound Name | CID 22358458 |
| PubChem CID | 22358458 |
| Molecular Formula | C4H9N2OSi |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | — |
| SMILES | CCCN([Si])C(N)=O |
| InChI | InChI=1S/C4H9N2OSi/c1-2-3-6(8)4(5)7/h2-3H2,1H3,(H2,5,7) |
| InChIKey | YLNPQJMOZROWBB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22358458 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22358458?
The IUPAC name of CID 22358458 (CID 22358458) is not available.
What is the SMILES notation for CID 22358458?
The canonical SMILES for CID 22358458 is CCCN([Si])C(N)=O.
What is the InChIKey of CID 22358458?
The InChIKey is YLNPQJMOZROWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2OSi/c1-2-3-6(8)4(5)7/h2-3H2,1H3,(H2,5,7).
What are the key properties of CID 22358458?
CID 22358458 has a molecular weight of 129.22 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22358458 is sourced from PubChem (CID 22358458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).