About 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione
3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione (PubChem CID 22362271) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione.
Molecular Properties
| Compound Name | 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione |
| PubChem CID | 22362271 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione |
| SMILES | CC(=O)C(=Cc1cc(C)c(O)c(C)c1)C(C)=O |
| InChI | InChI=1S/C14H16O3/c1-8-5-12(6-9(2)14(8)17)7-13(10(3)15)11(4)16/h5-7,17H,1-4H3 |
| InChIKey | IARPEGCWSPIGDW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione?
The IUPAC name of 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione (CID 22362271) is 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione.
What is the SMILES notation for 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione?
The canonical SMILES for 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione is CC(=O)C(=Cc1cc(C)c(O)c(C)c1)C(C)=O.
What is the InChIKey of 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione?
The InChIKey is IARPEGCWSPIGDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O3/c1-8-5-12(6-9(2)14(8)17)7-13(10(3)15)11(4)16/h5-7,17H,1-4H3.
What are the key properties of 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione?
3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione has a molecular weight of 232.28 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-hydroxy-3,5-dimethylphenyl)methylidene]pentane-2,4-dione is sourced from PubChem (CID 22362271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).