C20H20N4O3 — CID 22365802
2-hydroxy-1-[4-[[3-(2-methyltetrazol-5-yl)phenyl]methoxy]-3-prop-2-enylphenyl]ethanone (PubChem CID 22365802) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-hydroxy-1-[4-[[3-(2-methyltetrazol-5-yl)phenyl]methoxy]-3-prop-2-enylphenyl]ethanone.
| Compound Name | 2-hydroxy-1-[4-[[3-(2-methyltetrazol-5-yl)phenyl]methoxy]-3-prop-2-enylphenyl]ethanone |
|---|---|
| PubChem CID | 22365802 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-hydroxy-1-[4-[[3-(2-methyltetrazol-5-yl)phenyl]methoxy]-3-prop-2-enylphenyl]ethanone |
| SMILES | C=CCc1cc(C(=O)CO)ccc1OCc1cccc(-c2nnn(C)n2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-3-5-16-11-15(18(26)12-25)8-9-19(16)27-13-14-6-4-7-17(10-14)20-21-23-24(2)22-20/h3-4,6-11,25H,1,5,12-13H2,2H3 |
| InChIKey | TWKUVZBCNLSLQC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|