About hexan-2-ylbenzene
hexan-2-ylbenzene (PubChem CID 22385) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is hexan-2-ylbenzene.
Molecular Properties
| Compound Name | hexan-2-ylbenzene |
| PubChem CID | 22385 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | hexan-2-ylbenzene |
| SMILES | CCCCC(C)c1ccccc1 |
| InChI | InChI=1S/C12H18/c1-3-4-8-11(2)12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3 |
| InChIKey | CYBSWFUWEZFKNJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-ylbenzene?
The IUPAC name of hexan-2-ylbenzene (CID 22385) is hexan-2-ylbenzene.
What is the SMILES notation for hexan-2-ylbenzene?
The canonical SMILES for hexan-2-ylbenzene is CCCCC(C)c1ccccc1.
What is the InChIKey of hexan-2-ylbenzene?
The InChIKey is CYBSWFUWEZFKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-3-4-8-11(2)12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3.
What are the key properties of hexan-2-ylbenzene?
hexan-2-ylbenzene has a molecular weight of 162.28 g/mol, XLogP of 3.98, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-ylbenzene is sourced from PubChem (CID 22385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).