C14H16N4O3 — CID 22411234
4-amino-3-hydroxy-N-[4-(1H-imidazol-2-yl)-4-oxobutyl]benzamide (PubChem CID 22411234) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-[4-(1H-imidazol-2-yl)-4-oxobutyl]benzamide.
| Compound Name | 4-amino-3-hydroxy-N-[4-(1H-imidazol-2-yl)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 22411234 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 4-amino-3-hydroxy-N-[4-(1H-imidazol-2-yl)-4-oxobutyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCCCC(=O)c2ncc[nH]2)cc1O |
| InChI | InChI=1S/C14H16N4O3/c15-10-4-3-9(8-12(10)20)14(21)18-5-1-2-11(19)13-16-6-7-17-13/h3-4,6-8,20H,1-2,5,15H2,(H,16,17)(H,18,21) |
| InChIKey | GKDPPJMPYJUZON-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|