C15H16FN3O5S — CID 22411567
[4-[5-[2-[carbamoyl(hydroxy)amino]propylcarbamoyl]furan-2-yl]oxyphenyl] thiohypofluorite (PubChem CID 22411567) has the molecular formula C15H16FN3O5S and a molecular weight of 369.37 g/mol. Its IUPAC name is [4-[5-[2-[carbamoyl(hydroxy)amino]propylcarbamoyl]furan-2-yl]oxyphenyl] thiohypofluorite.
| Compound Name | [4-[5-[2-[carbamoyl(hydroxy)amino]propylcarbamoyl]furan-2-yl]oxyphenyl] thiohypofluorite |
|---|---|
| PubChem CID | 22411567 |
| Molecular Formula | C15H16FN3O5S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [4-[5-[2-[carbamoyl(hydroxy)amino]propylcarbamoyl]furan-2-yl]oxyphenyl] thiohypofluorite |
| SMILES | CC(CNC(=O)c1ccc(Oc2ccc(SF)cc2)o1)N(O)C(N)=O |
| InChI | InChI=1S/C15H16FN3O5S/c1-9(19(22)15(17)21)8-18-14(20)12-6-7-13(24-12)23-10-2-4-11(25-16)5-3-10/h2-7,9,22H,8H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | AMCMEBWHVLUATG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|