C11H10N2O3 — CID 22424947
methyl 2-oxo-1,5-dihydro-1,5-benzodiazepine-4-carboxylate (PubChem CID 22424947) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is methyl 2-oxo-1,5-dihydro-1,5-benzodiazepine-4-carboxylate.
| Compound Name | methyl 2-oxo-1,5-dihydro-1,5-benzodiazepine-4-carboxylate |
|---|---|
| PubChem CID | 22424947 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | methyl 2-oxo-1,5-dihydro-1,5-benzodiazepine-4-carboxylate |
| SMILES | COC(=O)C1=CC(=O)Nc2ccccc2N1 |
| InChI | InChI=1S/C11H10N2O3/c1-16-11(15)9-6-10(14)13-8-5-3-2-4-7(8)12-9/h2-6,12H,1H3,(H,13,14) |
| InChIKey | WWQAFGMIYMIFEC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |