C20H26BrN2O2+ — CID 2242951
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethanone (PubChem CID 2242951) has the molecular formula C20H26BrN2O2+ and a molecular weight of 406.34 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethanone.
| Compound Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethanone |
|---|---|
| PubChem CID | 2242951 |
| Molecular Formula | C20H26BrN2O2+ |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]ethanone |
| SMILES | Cc1cc(C(=O)C[NH+]2C[C@@H](C)O[C@H](C)C2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H25BrN2O2/c1-13-9-19(16(4)23(13)18-7-5-17(21)6-8-18)20(24)12-22-10-14(2)25-15(3)11-22/h5-9,14-15H,10-12H2,1-4H3/p+1/t14-,15-/m1/s1 |
| InChIKey | LDVRHZMPPATZTO-HUUCEWRRSA-O |
| XLogP | 2.73 |
| TPSA | 35.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|