C17H28O2 — CID 22447154
1,2-ditert-butyl-3-hydroperoxy-4-propan-2-ylbenzene (PubChem CID 22447154) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-hydroperoxy-4-propan-2-ylbenzene.
| Compound Name | 1,2-ditert-butyl-3-hydroperoxy-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 22447154 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1,2-ditert-butyl-3-hydroperoxy-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(C)(C)C)c(C(C)(C)C)c1OO |
| InChI | InChI=1S/C17H28O2/c1-11(2)12-9-10-13(16(3,4)5)14(15(12)19-18)17(6,7)8/h9-11,18H,1-8H3 |
| InChIKey | CZZYBCJWGHEXIP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|